* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FENOCTIMINE |
CAS: | 69365-65-7 |
English Synonyms: | FENOCTIMINE |
MDL Number.: | MFCD00866745 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | CCCCCCCC/N=C/N1CCC(CC1)C(c2ccccc2)c3ccccc3 |
InChi: | InChI=1S/C27H38N2/c1-2-3-4-5-6-13-20-28-23-29-21-18-26(19-22-29)27(24-14-9-7-10-15-24)25-16-11-8-12-17-25/h7-12,14-17,23,26-27H,2-6,13,18-22H2,1H3/b28-23+ |
InChiKey: | InChIKey=JXPCRJDMUSNASY-WEMUOSSPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.