* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SUBATHIZONE |
| CAS: | 121-55-1 |
| English Synonyms: | SUBATHIZONE |
| MDL Number.: | MFCD00866820 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | CCS(=O)(=O)c1ccc(cc1)/C=N/NC(=S)N |
| InChi: | InChI=1S/C10H13N3O2S2/c1-2-17(14,15)9-5-3-8(4-6-9)7-12-13-10(11)16/h3-7H,2H2,1H3,(H3,11,13,16)/b12-7+ |
| InChiKey: | InChIKey=VUSKMERTTCJJPM-KPKJPENVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.