* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FLUTAZOLAM |
CAS: | 27060-91-9 |
English Synonyms: | FLUTAZOLAM |
MDL Number.: | MFCD00866988 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | c1ccc(c(c1)C23c4cc(ccc4N(C(=O)CN2CCO3)CCO)Cl)F |
InChi: | InChI=1S/C19H18ClFN2O3/c20-13-5-6-17-15(11-13)19(14-3-1-2-4-16(14)21)22(8-10-26-19)12-18(25)23(17)7-9-24/h1-6,11,24H,7-10,12H2 |
InChiKey: | InChIKey=WMFSSTNVXWNLKI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.