* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FENPRINAST |
CAS: | 75184-94-0 |
English Synonyms: | FENPRINAST |
MDL Number.: | MFCD00867017 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | CC1(CN2C(=O)c3c(nc[nH]3)N(C2=N1)Cc4ccc(cc4)Cl)C |
InChi: | InChI=1S/C16H16ClN5O/c1-16(2)8-22-14(23)12-13(19-9-18-12)21(15(22)20-16)7-10-3-5-11(17)6-4-10/h3-6,9H,7-8H2,1-2H3,(H,18,19) |
InChiKey: | InChIKey=MXEAHCWVILOHDC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.