* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | DOXAPROST |
| CAS: | 51953-95-8 |
| English Synonyms: | DOXAPROST |
| MDL Number.: | MFCD00867018 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | CCCCCC(C)(/C=C/C1CCC(=O)[C@@H]1CCCCCCC(=O)O)O |
| InChi: | InChI=1S/C21H36O4/c1-3-4-9-15-21(2,25)16-14-17-12-13-19(22)18(17)10-7-5-6-8-11-20(23)24/h14,16-18,25H,3-13,15H2,1-2H3,(H,23,24)/b16-14+/t17?,18-,21?/m1/s1 |
| InChiKey: | InChIKey=KTEHTTNELUAQFC-UHFSOAMOSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.