* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SULOXIFEN |
| CAS: | 25827-12-7 |
| English Synonyms: | SULOXIFEN |
| MDL Number.: | MFCD00867019 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | CCN(CC)CCN=S(=O)(c1ccccc1)c2ccccc2 |
| InChi: | InChI=1S/C18H24N2OS/c1-3-20(4-2)16-15-19-22(21,17-11-7-5-8-12-17)18-13-9-6-10-14-18/h5-14H,3-4,15-16H2,1-2H3 |
| InChiKey: | InChIKey=HSOWGTFAGFRXKH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.