* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZINDOTRINE |
| CAS: | 56383-05-2 |
| English Synonyms: | ZINDOTRINE |
| MDL Number.: | MFCD00867025 |
| H bond acceptor: | 5 |
| H bond donor: | 0 |
| Smile: | Cc1cc(nn2c1nnc2)N3CCCCC3 |
| InChi: | InChI=1S/C11H15N5/c1-9-7-10(15-5-3-2-4-6-15)14-16-8-12-13-11(9)16/h7-8H,2-6H2,1H3 |
| InChiKey: | InChIKey=YYHWOTFWBVRTQD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.