* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | REPROTEROL |
CAS: | 54063-54-6 |
English Synonyms: | REPROTEROL |
MDL Number.: | MFCD00867032 |
H bond acceptor: | 10 |
H bond donor: | 4 |
Smile: | Cn1c2c(c(=O)n(c1=O)C)n(cn2)CCCNCC(c3cc(cc(c3)O)O)O |
InChi: | InChI=1S/C18H23N5O5/c1-21-16-15(17(27)22(2)18(21)28)23(10-20-16)5-3-4-19-9-14(26)11-6-12(24)8-13(25)7-11/h6-8,10,14,19,24-26H,3-5,9H2,1-2H3 |
InChiKey: | InChIKey=WVLAAKXASPCBGT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.