* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RACEFEMINE |
CAS: | 22232-57-1 |
English Synonyms: | RACEFEMINE |
MDL Number.: | MFCD00867154 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CC(Cc1ccccc1)NC(C)COc2ccccc2 |
InChi: | InChI=1S/C18H23NO/c1-15(13-17-9-5-3-6-10-17)19-16(2)14-20-18-11-7-4-8-12-18/h3-12,15-16,19H,13-14H2,1-2H3 |
InChiKey: | InChIKey=URCIJDUOBBSMII-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.