* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | IPROFENIN |
CAS: | 66292-53-3 |
English Synonyms: | IPROFENIN |
MDL Number.: | MFCD00867264 |
H bond acceptor: | 7 |
H bond donor: | 3 |
Smile: | CC(C)c1ccc(cc1)NC(=O)CN(CC(=O)O)CC(=O)O |
InChi: | InChI=1S/C15H20N2O5/c1-10(2)11-3-5-12(6-4-11)16-13(18)7-17(8-14(19)20)9-15(21)22/h3-6,10H,7-9H2,1-2H3,(H,16,18)(H,19,20)(H,21,22) |
InChiKey: | InChIKey=FPTRWYHXARAFPO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.