* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | QUINCARBATE |
CAS: | 54340-59-9 |
English Synonyms: | QUINCARBATE |
MDL Number.: | MFCD00867309 |
H bond acceptor: | 7 |
H bond donor: | 1 |
Smile: | CCOCC1COc2c(cc3c(c2Cl)c(=O)c(c[nH]3)C(=O)OCC)O1 |
InChi: | InChI=1S/C17H18ClNO6/c1-3-22-7-9-8-24-16-12(25-9)5-11-13(14(16)18)15(20)10(6-19-11)17(21)23-4-2/h5-6,9H,3-4,7-8H2,1-2H3,(H,19,20) |
InChiKey: | InChIKey=AZOPNLGKZVSIIQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.