* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FURACRINIC ACID |
CAS: | 23580-33-8 |
English Synonyms: | FURACRINIC ACID |
MDL Number.: | MFCD00867348 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCC(=C)C(=O)c1cc2cc(oc2cc1C)C(=O)O |
InChi: | InChI=1S/C15H14O4/c1-4-8(2)14(16)11-6-10-7-13(15(17)18)19-12(10)5-9(11)3/h5-7H,2,4H2,1,3H3,(H,17,18) |
InChiKey: | InChIKey=DLTWLXUYSLIIQN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.