* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FENESTREL |
CAS: | 7698-97-7 |
English Synonyms: | FENESTREL |
MDL Number.: | MFCD00867394 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CCC1C(C(CC=C1c2ccccc2)C(=O)O)C |
InChi: | InChI=1S/C16H20O2/c1-3-13-11(2)14(16(17)18)9-10-15(13)12-7-5-4-6-8-12/h4-8,10-11,13-14H,3,9H2,1-2H3,(H,17,18) |
InChiKey: | InChIKey=CLMFEXDZPBGYQQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.