* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FERRIC FRUCTOSE |
CAS: | 12286-76-9 |
English Synonyms: | FERRIC FRUCTOSE |
MDL Number.: | MFCD00867492 |
H bond acceptor: | 7 |
H bond donor: | 4 |
Smile: | C1C(C(C(C2(O1)CO[Fe-](O2)O)O)O)O.[K+] |
InChi: | InChI=1S/C6H10O6.Fe.K.H2O/c7-2-6(11)5(10)4(9)3(8)1-12-6;;;/h3-5,8-10H,1-2H2;;;1H2/q-2;+2;+1;/p-1 |
InChiKey: | InChIKey=FCAQRNFQZLWRNJ-UHFFFAOYSA-M |
* If the product has intellectual property rights, a license granted is must or contact us.