* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ROLETAMIDE |
CAS: | 10078-46-3 |
English Synonyms: | ROLETAMIDE |
MDL Number.: | MFCD00867534 |
H bond acceptor: | 5 |
H bond donor: | 0 |
Smile: | COc1cc(cc(c1OC)OC)C(=O)/C=C/N2CC=CC2 |
InChi: | InChI=1S/C16H19NO4/c1-19-14-10-12(11-15(20-2)16(14)21-3)13(18)6-9-17-7-4-5-8-17/h4-6,9-11H,7-8H2,1-3H3/b9-6+ |
InChiKey: | InChIKey=QECAKYKTTYQVKX-RMKNXTFCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.