* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FENPROSTALENE |
CAS: | 69381-94-8 |
English Synonyms: | FENPROSTALENE |
MDL Number.: | MFCD00867649 |
H bond acceptor: | 6 |
H bond donor: | 3 |
Smile: | COC(=O)CCC=C=CC[C@H]1C(C[C@H](C1/C=C/[C@H](COc2ccccc2)O)O)O |
InChi: | InChI=1S/C23H30O6/c1-28-23(27)12-8-3-2-7-11-19-20(22(26)15-21(19)25)14-13-17(24)16-29-18-9-5-4-6-10-18/h3-7,9-10,13-14,17,19-22,24-26H,8,11-12,15-16H2,1H3/b14-13+/t2?,17-,19-,20?,21?,22-/m1/s1 |
InChiKey: | InChIKey=BYNHBQROLKAEDQ-CSBHJGMLSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.