* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VETRABUTINE |
| CAS: | 3735-45-3 |
| English Synonyms: | VETRABUTINE |
| MDL Number.: | MFCD00867694 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | CN(C)C(CCCc1ccccc1)c2ccc(c(c2)OC)OC |
| InChi: | InChI=1S/C20H27NO2/c1-21(2)18(12-8-11-16-9-6-5-7-10-16)17-13-14-19(22-3)20(15-17)23-4/h5-7,9-10,13-15,18H,8,11-12H2,1-4H3 |
| InChiKey: | InChIKey=HEFVRVOEBZDOJU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.