* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ROLODINE |
CAS: | 1866-43-9 |
English Synonyms: | ROLODINE |
MDL Number.: | MFCD00867705 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | Cc1nc2c(cc[nH]2)c(n1)NCc3ccccc3 |
InChi: | InChI=1S/C14H14N4/c1-10-17-13-12(7-8-15-13)14(18-10)16-9-11-5-3-2-4-6-11/h2-8H,9H2,1H3,(H2,15,16,17,18) |
InChiKey: | InChIKey=HPZHFGBKCGWNGN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.