* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BEREFRINE |
| CAS: | 105567-83-7 |
| English Synonyms: | BEREFRINE |
| MDL Number.: | MFCD00867727 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CC(C)(C)C1N(C[C@H](O1)c2cccc(c2)O)C |
| InChi: | InChI=1S/C14H21NO2/c1-14(2,3)13-15(4)9-12(17-13)10-6-5-7-11(16)8-10/h5-8,12-13,16H,9H2,1-4H3/t12-,13?/m0/s1 |
| InChiKey: | InChIKey=ORIOFGXXYYXLNY-UEWDXFNNSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.