* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZUCLOPENTHIXOL |
| CAS: | 53772-83-1 |
| English Synonyms: | ZUCLOPENTHIXOL |
| MDL Number.: | MFCD00867744 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | c1ccc2c(c1)/C(=C/CCN3CCN(CC3)CCO)/c4cc(ccc4S2)Cl |
| InChi: | InChI=1S/C22H25ClN2OS/c23-17-7-8-22-20(16-17)18(19-4-1-2-6-21(19)27-22)5-3-9-24-10-12-25(13-11-24)14-15-26/h1-2,4-8,16,26H,3,9-15H2/b18-5- |
| InChiKey: | InChIKey=WFPIAZLQTJBIFN-DVZOWYKESA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.