* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | OXAGRELATE |
| CAS: | 56611-65-5 |
| English Synonyms: | OXAGRELATE |
| MDL Number.: | MFCD00867844 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | CCOC(=O)c1c(cc2c(n[nH]c(=O)c2c1C)CO)C |
| InChi: | InChI=1S/C14H16N2O4/c1-4-20-14(19)11-7(2)5-9-10(6-17)15-16-13(18)12(9)8(11)3/h5,17H,4,6H2,1-3H3,(H,16,18) |
| InChiKey: | InChIKey=DUQOOLBWGUKRAJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.