* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PENTAGESTRONE |
| CAS: | 7001-56-1 |
| English Synonyms: | PENTAGESTRONE |
| MDL Number.: | MFCD00867875 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CC(=O)[C@]1(CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@]3(CCC(=C4)OC5CCCC5)C)C)O |
| InChi: | InChI=1S/C26H38O3/c1-17(27)26(28)15-12-23-21-9-8-18-16-20(29-19-6-4-5-7-19)10-13-24(18,2)22(21)11-14-25(23,26)3/h8,16,19,21-23,28H,4-7,9-15H2,1-3H3/t21-,22+,23+,24+,25+,26+/m1/s1 |
| InChiKey: | InChIKey=RBFQPFFCDLXWQK-UXUCURBISA-N |
* If the product has intellectual property rights, a license granted is must or contact us.