* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GEMEPROST |
| CAS: | 64318-79-2 |
| English Synonyms: | GEMEPROST |
| MDL Number.: | MFCD00867892 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | CCCCC(C)(C)[C@@H](/C=C/[C@H]1[C@@H](CC(=O)[C@@H]1CCCC/C=C/C(=O)OC)O)O |
| InChi: | InChI=1S/C23H38O5/c1-5-6-15-23(2,3)21(26)14-13-18-17(19(24)16-20(18)25)11-9-7-8-10-12-22(27)28-4/h10,12-14,17-18,20-21,25-26H,5-9,11,15-16H2,1-4H3/b12-10+,14-13+/t17-,18-,20-,21-/m1/s1 |
| InChiKey: | InChIKey=KYBOHGVERHWSSV-VNIVIJDLSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.