* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | IOBENZAMIC ACID |
CAS: | 3115-05-7 |
English Synonyms: | IOBENZAMIC ACID |
MDL Number.: | MFCD00867919 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | c1ccc(cc1)N(CCC(=O)O)C(=O)c2c(cc(c(c2I)N)I)I |
InChi: | InChI=1S/C16H13I3N2O3/c17-10-8-11(18)15(20)14(19)13(10)16(24)21(7-6-12(22)23)9-4-2-1-3-5-9/h1-5,8H,6-7,20H2,(H,22,23) |
InChiKey: | InChIKey=FJYJNLIEGUTPIJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.