* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | IODOXAMIC ACID |
| CAS: | 31127-82-9 |
| English Synonyms: | IODOXAMIC ACID |
| MDL Number.: | MFCD00867934 |
| H bond acceptor: | 12 |
| H bond donor: | 4 |
| Smile: | c1c(c(c(c(c1I)NC(=O)CCOCCOCCOCCOCCC(=O)Nc2c(cc(c(c2I)C(=O)O)I)I)I)C(=O)O)I |
| InChi: | InChI=1S/C26H26I6N2O10/c27-13-11-15(29)23(21(31)19(13)25(37)38)33-17(35)1-3-41-5-7-43-9-10-44-8-6-42-4-2-18(36)34-24-16(30)12-14(28)20(22(24)32)26(39)40/h11-12H,1-10H2,(H,33,35)(H,34,36)(H,37,38)(H,39,40) |
| InChiKey: | InChIKey=WWVAPFRKZMUPHZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.