* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | IOTASUL |
| CAS: | 71767-13-0 |
| English Synonyms: | IOTASUL |
| MDL Number.: | MFCD00867940 |
| H bond acceptor: | 20 |
| H bond donor: | 10 |
| Smile: | CN(CC(CO)O)C(=O)c1c(c(c(c(c1I)NC(=O)CCSCCC(=O)Nc2c(c(c(c(c2I)C(=O)N(C)CC(CO)O)I)C(=O)N(C)CC(CO)O)I)I)C(=O)N(C)CC(CO)O)I |
| InChi: | InChI=1S/C38H50I6N6O14S/c1-47(9-17(55)13-51)35(61)23-27(39)24(36(62)48(2)10-18(56)14-52)30(42)33(29(23)41)45-21(59)5-7-65-8-6-22(60)46-34-31(43)25(37(63)49(3)11-19(57)15-53)28(40)26(32(34)44)38(64)50(4)12-20(58)16-54/h17-20,51-58H,5-16H2,1-4H3,(H,45,59)(H,46,60) |
| InChiKey: | InChIKey=OQHLOKBHRXMXLD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.