* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | IOXOTRIZOIC ACID |
| CAS: | 19863-06-0 |
| English Synonyms: | IOXOTRIZOIC ACID |
| MDL Number.: | MFCD00867962 |
| H bond acceptor: | 7 |
| H bond donor: | 4 |
| Smile: | CC(=O)Nc1c(c(c(c(c1I)NC(=O)CO)I)C(=O)O)I |
| InChi: | InChI=1S/C11H9I3N2O5/c1-3(18)15-9-6(12)5(11(20)21)7(13)10(8(9)14)16-4(19)2-17/h17H,2H2,1H3,(H,15,18)(H,16,19)(H,20,21) |
| InChiKey: | InChIKey=KISFRFNQZTVXGT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.