* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | XYLAMIDINE |
| CAS: | 6443-50-1 |
| English Synonyms: | XYLAMIDINE |
| MDL Number.: | MFCD00868051 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | Cc1cccc(c1)CC(=N)NCC(C)Oc2cccc(c2)OC |
| InChi: | InChI=1S/C19H24N2O2/c1-14-6-4-7-16(10-14)11-19(20)21-13-15(2)23-18-9-5-8-17(12-18)22-3/h4-10,12,15H,11,13H2,1-3H3,(H2,20,21) |
| InChiKey: | InChIKey=JRYTUFKIORWTNI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.