* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ROLAFAGREL |
CAS: | 89781-55-5 |
English Synonyms: | ROLAFAGREL |
MDL Number.: | MFCD00868136 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | c1cc2c(cc1C(=O)O)C=C(CC2)n3ccnc3 |
InChi: | InChI=1S/C14H12N2O2/c17-14(18)11-2-1-10-3-4-13(8-12(10)7-11)16-6-5-15-9-16/h1-2,5-9H,3-4H2,(H,17,18) |
InChiKey: | InChIKey=DQEDSIVMYUUZCK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.