* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FLOREDIL |
CAS: | 53731-36-5 |
English Synonyms: | FLOREDIL |
MDL Number.: | MFCD00868235 |
H bond acceptor: | 5 |
H bond donor: | 0 |
Smile: | CCOc1cc(cc(c1)OCCN2CCOCC2)OCC |
InChi: | InChI=1S/C16H25NO4/c1-3-19-14-11-15(20-4-2)13-16(12-14)21-10-7-17-5-8-18-9-6-17/h11-13H,3-10H2,1-2H3 |
InChiKey: | InChIKey=MXVLJFCCQMXEEE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.