* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RIDAZOLOL |
CAS: | 83395-21-5 |
English Synonyms: | RIDAZOLOL |
MDL Number.: | MFCD00868293 |
H bond acceptor: | 7 |
H bond donor: | 4 |
Smile: | c1ccc(c(c1)OCC(CNCCNc2cn[nH]c(=O)c2Cl)O)Cl |
InChi: | InChI=1S/C15H18Cl2N4O3/c16-11-3-1-2-4-13(11)24-9-10(22)7-18-5-6-19-12-8-20-21-15(23)14(12)17/h1-4,8,10,18,22H,5-7,9H2,(H2,19,21,23) |
InChiKey: | InChIKey=UUWABVCZFXKHSU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.