* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GADOPENAMIDE |
| CAS: | 117827-80-2 |
| English Synonyms: | GADOPENAMIDE |
| MDL Number.: | MFCD00868334 |
| H bond acceptor: | 15 |
| H bond donor: | 0 |
| Smile: | C1CN(CC(=O)O[Gd]2OC(=O)CN1CCN(CC(=O)O2)CC(=O)N3CCOCC3)CC(=O)N4CCOCC4 |
| InChi: | InChI=1S/C22H37N5O10.Gd/c28-18(26-5-9-36-10-6-26)13-24(16-21(32)33)3-1-23(15-20(30)31)2-4-25(17-22(34)35)14-19(29)27-7-11-37-12-8-27;/h1-17H2,(H,30,31)(H,32,33)(H,34,35);/q;+3/p-3 |
| InChiKey: | InChIKey=DUKPLGYBRQILLM-UHFFFAOYSA-K |
* If the product has intellectual property rights, a license granted is must or contact us.