* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | XINIDAMINE |
| CAS: | 50264-78-3 |
| English Synonyms: | XINIDAMINE |
| MDL Number.: | MFCD00868343 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | Cc1ccc(c(c1)C)Cn2c3ccccc3c(n2)C(=O)O |
| InChi: | InChI=1S/C17H16N2O2/c1-11-7-8-13(12(2)9-11)10-19-15-6-4-3-5-14(15)16(18-19)17(20)21/h3-9H,10H2,1-2H3,(H,20,21) |
| InChiKey: | InChIKey=WHWIXTDKNBCRAS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.