* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | DIVABUTEROL |
| CAS: | 54592-27-7 |
| English Synonyms: | DIVABUTEROL |
| MDL Number.: | MFCD00868344 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | CC(C)(C)C(=O)Oc1cc(cc(c1)OC(=O)C(C)(C)C)C(CNC(C)(C)C)O |
| InChi: | InChI=1S/C22H35NO5/c1-20(2,3)18(25)27-15-10-14(17(24)13-23-22(7,8)9)11-16(12-15)28-19(26)21(4,5)6/h10-12,17,23-24H,13H2,1-9H3 |
| InChiKey: | InChIKey=VJJOKWOJJZKXNV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.