* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FUROFENAC |
CAS: | 56983-13-2 |
English Synonyms: | FUROFENAC |
MDL Number.: | MFCD00868354 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CCC1Cc2cc(ccc2O1)CC(=O)O |
InChi: | InChI=1S/C12H14O3/c1-2-10-7-9-5-8(6-12(13)14)3-4-11(9)15-10/h3-5,10H,2,6-7H2,1H3,(H,13,14) |
InChiKey: | InChIKey=MYQXHLQMZLTSDB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.