* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | REVENAST |
CAS: | 85673-87-6 |
English Synonyms: | REVENAST |
MDL Number.: | MFCD00868384 |
H bond acceptor: | 6 |
H bond donor: | 0 |
Smile: | c1ccc(cc1)c2cc(=O)n(n2c3ccccc3)CCCN4CCN(CC4)c5ccccn5 |
InChi: | InChI=1S/C27H29N5O/c33-27-22-25(23-10-3-1-4-11-23)32(24-12-5-2-6-13-24)31(27)17-9-16-29-18-20-30(21-19-29)26-14-7-8-15-28-26/h1-8,10-15,22H,9,16-21H2 |
InChiKey: | InChIKey=NOSNJBQFOSLJCA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.