* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RILAPINE |
CAS: | 79781-95-6 |
English Synonyms: | RILAPINE |
MDL Number.: | MFCD00868424 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | CN1CCN(CC1)C2=Cc3cc(ccc3/C(=C/C#N)/c4c2cccc4)Cl |
InChi: | InChI=1S/C22H20ClN3/c1-25-10-12-26(13-11-25)22-15-16-14-17(23)6-7-18(16)20(8-9-24)19-4-2-3-5-21(19)22/h2-8,14-15H,10-13H2,1H3/b20-8- |
InChiKey: | InChIKey=UJCYUJOQBXHJFH-ZBKNUEDVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.