* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RENTIAPRIL |
CAS: | 72679-47-1 ;80830-42-8 |
English Synonyms: | RENTIAPRIL |
MDL Number.: | MFCD00868438 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | c1ccc(c(c1)[C@@H]2N([C@@H](CS2)C(=O)O)C(=O)CCS)O |
InChi: | InChI=1S/C13H15NO4S2/c15-10-4-2-1-3-8(10)12-14(11(16)5-6-19)9(7-20-12)13(17)18/h1-4,9,12,15,19H,5-7H2,(H,17,18)/t9-,12+/m0/s1 |
InChiKey: | InChIKey=BSHDUMDXSRLRBI-JOYOIKCWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.