* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GLIBUTIMINE |
| CAS: | 25859-76-1 |
| English Synonyms: | GLIBUTIMINE |
| MDL Number.: | MFCD00868442 |
| H bond acceptor: | 7 |
| H bond donor: | 2 |
| Smile: | CCCC(=O)NCCc1ccc(cc1)S(=O)(=O)N2CCN(C2=N)C3CCC=CC3 |
| InChi: | InChI=1S/C21H30N4O3S/c1-2-6-20(26)23-14-13-17-9-11-19(12-10-17)29(27,28)25-16-15-24(21(25)22)18-7-4-3-5-8-18/h3-4,9-12,18,22H,2,5-8,13-16H2,1H3,(H,23,26) |
| InChiKey: | InChIKey=NFGPIRVQFCRUFC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.