* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RAMCICLANE |
CAS: | 96743-96-3 |
English Synonyms: | RAMCICLANE |
MDL Number.: | MFCD00868481 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | CC1([C@H]2CC[C@]1(C(C2)(Cc3ccccc3)OCCN(C)C)C)C |
InChi: | InChI=1S/C21H33NO/c1-19(2)18-11-12-20(19,3)21(16-18,23-14-13-22(4)5)15-17-9-7-6-8-10-17/h6-10,18H,11-16H2,1-5H3/t18-,20+,21?/m0/s1 |
InChiKey: | InChIKey=XAZVHBVUJRRLHH-PALXJHBUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.