* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | XENYHEXENIC ACID |
| CAS: | 964-82-9 |
| English Synonyms: | XENYHEXENIC ACID |
| MDL Number.: | MFCD00868534 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | C/C=C/CC(c1ccc(cc1)c2ccccc2)C(=O)O |
| InChi: | InChI=1S/C18H18O2/c1-2-3-9-17(18(19)20)16-12-10-15(11-13-16)14-7-5-4-6-8-14/h2-8,10-13,17H,9H2,1H3,(H,19,20)/b3-2+ |
| InChiKey: | InChIKey=ZVRCODPBROUJIT-NSCUHMNNSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.