* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | QUINOTOLAST |
| CAS: | 101193-40-2 |
| English Synonyms: | QUINOTOLAST |
| MDL Number.: | MFCD00868604 |
| H bond acceptor: | 9 |
| H bond donor: | 2 |
| Smile: | c1ccc(cc1)Oc2cc(c(=O)n3c2cccc3)C(=O)Nc4[nH]nnn4 |
| InChi: | InChI=1S/C17H12N6O3/c24-15(18-17-19-21-22-20-17)12-10-14(26-11-6-2-1-3-7-11)13-8-4-5-9-23(13)16(12)25/h1-10H,(H2,18,19,20,21,22,24) |
| InChiKey: | InChIKey=ZUPLNRDTYQWUHP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.