* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RILOZARONE |
CAS: | 79282-39-6 |
English Synonyms: | RILOZARONE |
MDL Number.: | MFCD00868635 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | CCCCN(CCCC)CCCOc1ccc(cc1Cl)C(=O)c2c(c(c3n2cccc3)Br)c4ccccc4 |
InChi: | InChI=1S/C32H36BrClN2O2/c1-3-5-18-35(19-6-4-2)20-12-22-38-28-17-16-25(23-26(28)34)32(37)31-29(24-13-8-7-9-14-24)30(33)27-15-10-11-21-36(27)31/h7-11,13-17,21,23H,3-6,12,18-20,22H2,1-2H3 |
InChiKey: | InChIKey=FXUPBFVDIVRFCX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.