* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FEPITRIZOL |
CAS: | 53415-46-6 |
English Synonyms: | FEPITRIZOL |
MDL Number.: | MFCD00868656 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | Cn1c(nc(n1)c2cccnc2)c3ccccc3CO |
InChi: | InChI=1S/C15H14N4O/c1-19-15(13-7-3-2-5-12(13)10-20)17-14(18-19)11-6-4-8-16-9-11/h2-9,20H,10H2,1H3 |
InChiKey: | InChIKey=UDBQGHIODMCIFZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.