* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FLUTIZENOL |
| CAS: | 10202-40-1 |
| English Synonyms: | FLUTIZENOL |
| MDL Number.: | MFCD00868679 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | c1cc2c(cc1C(F)(F)F)N(c3ccsc3S2)CCCN4CCN(CC4)CCO |
| InChi: | InChI=1S/C20H24F3N3OS2/c21-20(22,23)15-2-3-18-17(14-15)26(16-4-13-28-19(16)29-18)6-1-5-24-7-9-25(10-8-24)11-12-27/h2-4,13-14,27H,1,5-12H2 |
| InChiKey: | InChIKey=HDPDWVAJUZMKRW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.