* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | IOLIDONIC ACID |
CAS: | 21766-53-0 |
English Synonyms: | IOLIDONIC ACID |
MDL Number.: | MFCD00868688 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCC(Cc1c(cc(c(c1I)N2CCCC2=O)I)I)C(=O)O |
InChi: | InChI=1S/C15H16I3NO3/c1-2-8(15(21)22)6-9-10(16)7-11(17)14(13(9)18)19-5-3-4-12(19)20/h7-8H,2-6H2,1H3,(H,21,22) |
InChiKey: | InChIKey=MJGWMPWEXXUAPD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.