* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | FEPROMIDE |
CAS: | 54063-41-1 |
English Synonyms: | FEPROMIDE |
MDL Number.: | MFCD00868709 |
H bond acceptor: | 7 |
H bond donor: | 1 |
Smile: | COc1cc(cc(c1OC)OC)C(=O)NC(CN2CCCC2)COc3ccccc3 |
InChi: | InChI=1S/C23H30N2O5/c1-27-20-13-17(14-21(28-2)22(20)29-3)23(26)24-18(15-25-11-7-8-12-25)16-30-19-9-5-4-6-10-19/h4-6,9-10,13-14,18H,7-8,11-12,15-16H2,1-3H3,(H,24,26) |
InChiKey: | InChIKey=QFSBWEZVTZCUPC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.