* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SELPRAZINE |
| CAS: | 103997-59-7 |
| English Synonyms: | SELPRAZINE |
| MDL Number.: | MFCD00868736 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | CCOc1ccccc1N2CCN(CC2)CCCOc3ccc4c(c3)CCC(=O)N4 |
| InChi: | InChI=1S/C24H31N3O3/c1-2-29-23-7-4-3-6-22(23)27-15-13-26(14-16-27)12-5-17-30-20-9-10-21-19(18-20)8-11-24(28)25-21/h3-4,6-7,9-10,18H,2,5,8,11-17H2,1H3,(H,25,28) |
| InChiKey: | InChIKey=PSFSFRWKLXZAQY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.