* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FROXIPROST |
CAS: | 62559-74-4 |
English Synonyms: | FROXIPROST |
MDL Number.: | MFCD00868749 |
H bond acceptor: | 6 |
H bond donor: | 3 |
Smile: | COC(=O)/C=C/C/C=C\C[C@H]1[C@H](C[C@H]([C@@H]1/C=C/[C@H](COc2cccc(c2)C(F)(F)F)O)O)O |
InChi: | InChI=1S/C24H29F3O6/c1-32-23(31)10-5-3-2-4-9-19-20(22(30)14-21(19)29)12-11-17(28)15-33-18-8-6-7-16(13-18)24(25,26)27/h2,4-8,10-13,17,19-22,28-30H,3,9,14-15H2,1H3/b4-2-,10-5+,12-11+/t17-,19-,20-,21+,22-/m1/s1 |
InChiKey: | InChIKey=REFZGTXXBBUTMJ-YDQNNXAVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.