* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | QUILLIFOLINE |
CAS: | 15301-89-0 |
English Synonyms: | QUILLIFOLINE |
MDL Number.: | MFCD00868816 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | COc1cc2c(cc1OC)C3CC(CCN3CC2)c4ccc(cc4)Cl |
InChi: | InChI=1S/C21H24ClNO2/c1-24-20-12-16-8-10-23-9-7-15(14-3-5-17(22)6-4-14)11-19(23)18(16)13-21(20)25-2/h3-6,12-13,15,19H,7-11H2,1-2H3 |
InChiKey: | InChIKey=GMZAHGCTRHHQKR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.